CAS 1160264-11-8
:2-[(4-Aminobenzoyl)oxy]-1-phenyl-1-propanone
Description:
2-[(4-Aminobenzoyl)oxy]-1-phenyl-1-propanone, also known by its CAS number 1160264-11-8, is an organic compound characterized by its functional groups and structural features. It contains a phenyl group, a propanone moiety, and an amine-substituted benzoyl group, which contribute to its chemical reactivity and potential applications. The presence of the amine group suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. This compound is likely to exhibit properties typical of ketones and amides, such as moderate polarity and potential for electrophilic reactions. Its structural complexity may also allow for various synthetic pathways, making it of interest in organic synthesis and medicinal chemistry. Additionally, compounds with similar structures are often investigated for their biological activities, including potential pharmaceutical applications. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise characterization.
Formula:C16H15NO3
InChI:InChI=1S/C16H15NO3/c1-11(15(18)12-5-3-2-4-6-12)20-16(19)13-7-9-14(17)10-8-13/h2-11H,17H2,1H3
InChI key:InChIKey=ZCEZRWHJATUUOH-UHFFFAOYSA-N
SMILES:C(OC(C(=O)C1=CC=CC=C1)C)(=O)C2=CC=C(N)C=C2
Synonyms:- 2-[(4-Aminobenzoyl)oxy]-1-phenyl-1-propanone
- 1-Propanone, 2-[(4-aminobenzoyl)oxy]-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.