CymitQuimica logo

CAS 1160264-13-0

:

2-[(4-Aminobenzoyl)oxy]-1-(4-methylphenyl)-1-propanone

Description:
2-[(4-Aminobenzoyl)oxy]-1-(4-methylphenyl)-1-propanone, identified by its CAS number 1160264-13-0, is an organic compound characterized by its complex structure, which includes an amine group, a benzoyl moiety, and a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the 4-aminobenzoyl group suggests that it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties such as melting point and boiling point. Additionally, the methyl group on the phenyl ring can affect the compound's electronic properties and steric hindrance, which may play a role in its reactivity and stability. This compound may find applications in fields such as pharmaceuticals, materials science, or as an intermediate in organic synthesis, although specific applications would depend on further research and characterization.
Formula:C17H17NO3
InChI:InChI=1S/C17H17NO3/c1-11-3-5-13(6-4-11)16(19)12(2)21-17(20)14-7-9-15(18)10-8-14/h3-10,12H,18H2,1-2H3
InChI key:InChIKey=IQKYKZPHTUXGGU-UHFFFAOYSA-N
SMILES:C(C(OC(=O)C1=CC=C(N)C=C1)C)(=O)C2=CC=C(C)C=C2
Synonyms:
  • 2-[(4-Aminobenzoyl)oxy]-1-(4-methylphenyl)-1-propanone
  • 1-Propanone, 2-[(4-aminobenzoyl)oxy]-1-(4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.