CAS 1160264-15-2
:6-[3-Amino-4-[(phenylmethyl)amino]phenyl]-3(2H)-pyridazinone
Description:
6-[3-Amino-4-[(phenylmethyl)amino]phenyl]-3(2H)-pyridazinone, with the CAS number 1160264-15-2, is a chemical compound characterized by its complex structure, which includes a pyridazinone core and multiple amino groups. This compound typically exhibits properties associated with its functional groups, such as potential solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. The phenylmethyl substituent may contribute to its lipophilicity, influencing its interaction with biological systems. The compound may also display biological activity, potentially acting as a pharmaceutical agent, given its structural features that are often associated with drug-like properties. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. Additionally, the compound's stability, reactivity, and potential applications in medicinal chemistry would be of interest for further research and development. Overall, this substance represents a class of compounds that could be explored for therapeutic uses, pending further investigation into its biological effects and mechanisms of action.
Formula:C17H16N4O
InChI:InChI=1S/C17H16N4O/c18-14-10-13(15-8-9-17(22)21-20-15)6-7-16(14)19-11-12-4-2-1-3-5-12/h1-10,19H,11,18H2,(H,21,22)
InChI key:InChIKey=DXDNVHPKAPSAQQ-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1NCC2=CC=CC=C2)C=3C=CC(=O)NN3
Synonyms:- 3(2H)-Pyridazinone, 6-[3-amino-4-[(phenylmethyl)amino]phenyl]-
- 6-[3-Amino-4-[(phenylmethyl)amino]phenyl]-3(2H)-pyridazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.