CAS 1160264-16-3

2-[(4-Aminobenzoyl)oxy]-1-(4-methoxyphenyl)-1-propanone

Description:

2-[(4-Aminobenzoyl)oxy]-1-(4-methoxyphenyl)-1-propanone, identified by its CAS number 1160264-16-3, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both an aminobenzoyl and a methoxyphenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the amino group suggests potential for hydrogen bonding and increased polarity, while the methoxy group can influence the electronic properties and steric hindrance of the molecule. As a result, this compound may be of interest in various applications, including pharmaceuticals, where it could serve as an intermediate or active ingredient due to its potential biological activity. Its stability, solubility in organic solvents, and reactivity with other functional groups would be critical factors in its practical applications. Further studies would be necessary to fully elucidate its properties and potential uses in chemical synthesis or medicinal chemistry.

Formula: C₁₇H₁₇NO₄

InChI: InChI=1S/C17H17NO4/c1-11(16(19)12-5-9-15(21-2)10-6-12)22-17(20)13-3-7-14(18)8-4-13/h3-11H,18H2,1-2H3

InChI key: InChIKey=SRFJZQDPQLYRGL-UHFFFAOYSA-N

SMILES: C(C(OC(=O)C1=CC=C(N)C=C1)C)(=O)C2=CC=C(OC)C=C2

Synonyms:

• 2-[(4-Aminobenzoyl)oxy]-1-(4-methoxyphenyl)-1-propanone
• 1-Propanone, 2-[(4-aminobenzoyl)oxy]-1-(4-methoxyphenyl)-
• 1-(4-Methoxyphenyl)-1-oxopropan-2-yl 4-aminobenzoate
• 2-(4-methoxyphenyl)-1-methyl-2-oxoethyl 4-aminobenzoate