CAS 1160264-30-1

Ethyl 2-(hexahydro-1H-azepin-1-yl)-4-methyl-5-thiazolecarboxylate

Description:

Ethyl 2-(hexahydro-1H-azepin-1-yl)-4-methyl-5-thiazolecarboxylate is a chemical compound characterized by its unique structural features, which include a thiazole ring and a hexahydroazepine moiety. This compound typically exhibits properties associated with both thiazole and amine functionalities, which may influence its reactivity and potential applications in medicinal chemistry. The presence of the ethyl ester group suggests that it may participate in esterification or hydrolysis reactions, while the thiazole ring can contribute to biological activity, potentially making it of interest in drug development. Additionally, the hexahydroazepine structure may impart certain steric and electronic properties that affect the compound's interaction with biological targets. Overall, this compound's characteristics, including its molecular weight, solubility, and stability, would be essential for understanding its behavior in various chemical environments and its potential utility in pharmaceutical applications. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.

Formula: C₁₃H₂₀N₂O₂S

InChI: InChI=1S/C13H20N2O2S/c1-3-17-12(16)11-10(2)14-13(18-11)15-8-6-4-5-7-9-15/h3-9H2,1-2H3

InChI key: InChIKey=VBJXCGICGLHAKM-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(=NC1C)N2CCCCCC2

Synonyms:

• Ethyl 2-(hexahydro-1H-azepin-1-yl)-4-methyl-5-thiazolecarboxylate
• 5-Thiazolecarboxylic acid, 2-(hexahydro-1H-azepin-1-yl)-4-methyl-, ethyl ester