CAS 1160264-31-2

Hexahydro-1-(4-methyl-2-thiazolyl)-1H-azepine

Description:

Hexahydro-1-(4-methyl-2-thiazolyl)-1H-azepine is a chemical compound characterized by its unique bicyclic structure, which includes a saturated azepine ring fused with a thiazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of the thiazole ring, which is known for its role in various pharmacological applications. The presence of the methyl group on the thiazole contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. Hexahydro-1-(4-methyl-2-thiazolyl)-1H-azepine may also display interesting reactivity patterns due to the nitrogen atoms in its structure, which can participate in various chemical reactions. Its applications may span across medicinal chemistry, where it could serve as a lead compound for drug development, particularly in areas targeting neurological or infectious diseases. As with any chemical substance, safety data and handling precautions should be considered when working with this compound in a laboratory setting.

Formula: C₁₀H₁₆N₂S

InChI: InChI=1S/C10H16N2S/c1-9-8-13-10(11-9)12-6-4-2-3-5-7-12/h8H,2-7H2,1H3

InChI key: InChIKey=PRQXADOOORIULT-UHFFFAOYSA-N

SMILES: CC=1N=C(SC1)N2CCCCCC2

Synonyms:

• Hexahydro-1-(4-methyl-2-thiazolyl)-1H-azepine
• 1H-Azepine, hexahydro-1-(4-methyl-2-thiazolyl)-