CAS 1160264-32-3

1-(2,2-Dimethoxyethyl)-1H-imidazole-2-carboxaldehyde oxime

Description:

1-(2,2-Dimethoxyethyl)-1H-imidazole-2-carboxaldehyde oxime is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a carboxaldehyde functional group, which is reactive and can participate in various chemical reactions, including condensation and oxidation. The presence of the oxime functional group, derived from the reaction of the aldehyde with hydroxylamine, imparts additional reactivity and can influence the compound's biological activity. The dimethoxyethyl substituent enhances the solubility and stability of the compound in various solvents. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and biological activities would depend on further research and characterization. As with many organic compounds, safety data should be consulted before handling, as it may pose risks such as irritation or toxicity. Overall, this compound represents a unique structure that could be valuable in synthetic chemistry and drug development.

Formula: C₈H₁₃N₃O₃

InChI: InChI=1S/C8H13N3O3/c1-13-8(14-2)6-11-4-3-9-7(11)5-10-12/h3-5,8,12H,6H2,1-2H3

InChI key: InChIKey=SULVYDYFKGMGEN-UHFFFAOYSA-N

SMILES: C(C(OC)OC)N1C(C=NO)=NC=C1

Synonyms:

• 1H-Imidazole-2-carboxaldehyde, 1-(2,2-dimethoxyethyl)-, oxime
• 1-(2,2-Dimethoxyethyl)-1H-imidazole-2-carboxaldehyde oxime