CymitQuimica logo

CAS 1160264-34-5

:

5-Chloro-N-[2-(1-pyrrolidinyl)ethyl]-2-pyrazinecarboxamide

Description:
5-Chloro-N-[2-(1-pyrrolidinyl)ethyl]-2-pyrazinecarboxamide is a chemical compound characterized by its unique structural features, which include a pyrazine ring and a chloro substituent. The presence of the pyrrolidine moiety contributes to its potential biological activity, as this nitrogen-containing heterocycle is often associated with various pharmacological properties. The compound's carboxamide functional group enhances its solubility and reactivity, making it suitable for interactions with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The compound's CAS number, 1160264-34-5, allows for precise identification and retrieval of information in chemical databases. Overall, the characteristics of this substance indicate its relevance in research and development, particularly in the fields of drug discovery and organic synthesis. Further studies would be necessary to elucidate its specific biological activities and potential applications.
Formula:C11H15ClN4O
InChI:InChI=1S/C11H15ClN4O/c12-10-8-14-9(7-15-10)11(17)13-3-6-16-4-1-2-5-16/h7-8H,1-6H2,(H,13,17)
InChI key:InChIKey=WAGRVYYIQAZFCU-UHFFFAOYSA-N
SMILES:C(NCCN1CCCC1)(=O)C=2C=NC(Cl)=CN2
Synonyms:
  • 2-Pyrazinecarboxamide, 5-chloro-N-[2-(1-pyrrolidinyl)ethyl]-
  • 5-Chloro-N-[2-(1-pyrrolidinyl)ethyl]-2-pyrazinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.