CAS 1160264-38-9
:2-Methyl-N-[3-(1-methylethyl)-1H-1,2,4-triazol-5-yl]propanamide
Description:
2-Methyl-N-[3-(1-methylethyl)-1H-1,2,4-triazol-5-yl]propanamide is a chemical compound characterized by its unique structure, which includes a triazole ring and an amide functional group. This compound features a branched alkyl chain, contributing to its hydrophobic properties, while the triazole moiety may impart biological activity, often associated with antifungal or herbicidal properties. The presence of the methyl group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. The compound's molecular interactions can be influenced by the amide bond, which can participate in hydrogen bonding, affecting its stability and reactivity. Additionally, the specific arrangement of substituents around the triazole ring can lead to diverse pharmacological effects. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and agricultural science, where it may serve as a lead compound for further development.
Formula:C9H16N4O
InChI:InChI=1S/C9H16N4O/c1-5(2)7-10-9(13-12-7)11-8(14)6(3)4/h5-6H,1-4H3,(H2,10,11,12,13,14)
InChI key:InChIKey=SLYUVNAQTRNYDK-UHFFFAOYSA-N
SMILES:N(C(C(C)C)=O)C=1NC(C(C)C)=NN1
Synonyms:- Propanamide, 2-methyl-N-[3-(1-methylethyl)-1H-1,2,4-triazol-5-yl]-
- 2-Methyl-N-[3-(1-methylethyl)-1H-1,2,4-triazol-5-yl]propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.