CymitQuimica logo

CAS 1160264-44-7

:

3,5-Diamino-2-cyano-5-oxo-2-pentenoic acid

Description:
3,5-Diamino-2-cyano-5-oxo-2-pentenoic acid, identified by its CAS number 1160264-44-7, is a chemical compound characterized by its unique structural features, including multiple functional groups. It contains two amino groups (-NH2), a cyano group (-C≡N), and a keto group (C=O), which contribute to its reactivity and potential biological activity. The presence of these functional groups suggests that the compound may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Its structure indicates that it could be involved in metabolic pathways or serve as an intermediate in the synthesis of more complex molecules. Additionally, the compound's properties may include solubility in polar solvents due to the presence of amino and carboxylic acid functionalities. The compound's potential applications could span fields such as pharmaceuticals, agrochemicals, or materials science, depending on its biological activity and stability. However, specific data regarding its toxicity, stability, and detailed reactivity would require further investigation and characterization.
Formula:C6H7N3O3
InChI:InChI=1S/C6H7N3O3/c7-2-3(6(11)12)4(8)1-5(9)10/h1,8H2,(H2,9,10)(H,11,12)
InChI key:InChIKey=NDFKZNWOJRIMHX-UHFFFAOYSA-N
SMILES:C(=C(CC(N)=O)N)(C(O)=O)C#N
Synonyms:
  • 2-Pentenoic acid, 3,5-diamino-2-cyano-5-oxo-
  • 3,5-Diamino-2-cyano-5-oxo-2-pentenoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.