CAS 1160264-47-0
:N-[2-(1-Pyrrolidinylsulfonyl)ethyl]-3-pyridinemethanamine
Description:
N-[2-(1-Pyrrolidinylsulfonyl)ethyl]-3-pyridinemethanamine, identified by its CAS number 1160264-47-0, is a chemical compound characterized by its complex structure that includes a pyridine ring and a sulfonyl group. This compound typically exhibits properties associated with amines and sulfonamides, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of nitrogen and sulfur atoms. The pyridine moiety contributes to its aromatic character, which may influence its reactivity and interaction with biological targets. Additionally, the presence of the pyrrolidine ring suggests potential for conformational flexibility, which can affect its pharmacological properties. Such compounds are often investigated for their biological activity, including potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Overall, the specific characteristics, including its stability, reactivity, and biological activity, would depend on the precise molecular interactions and the environment in which the compound is studied.
Formula:C12H19N3O2S
InChI:InChI=1S/C12H19N3O2S/c16-18(17,15-7-1-2-8-15)9-6-14-11-12-4-3-5-13-10-12/h3-5,10,14H,1-2,6-9,11H2
InChI key:InChIKey=PXNKULDUBBRGMR-UHFFFAOYSA-N
SMILES:S(CCNCC=1C=CC=NC1)(=O)(=O)N2CCCC2
Synonyms:- 3-Pyridinemethanamine, N-[2-(1-pyrrolidinylsulfonyl)ethyl]-
- N-[2-(1-Pyrrolidinylsulfonyl)ethyl]-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.