CAS 1160264-54-9

2-[2-Fluoro-3-(trifluoromethyl)phenoxy]-4-pyridinecarboxylic acid

Description:

2-[2-Fluoro-3-(trifluoromethyl)phenoxy]-4-pyridinecarboxylic acid, identified by its CAS number 1160264-54-9, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenoxy group substituted with fluorine and trifluoromethyl groups. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The fluorine atoms contribute to its lipophilicity and may enhance its biological activity, making it of interest in pharmaceutical research. The carboxylic acid functional group can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Additionally, the presence of multiple fluorine atoms often imparts unique electronic properties, which can affect the compound's reactivity and stability. Overall, this compound's characteristics make it a subject of interest in various fields, including medicinal chemistry and materials science, where its specific interactions and properties can be leveraged for innovative applications.

Formula: C₁₃H₇F₄NO₃

InChI: InChI=1S/C13H7F4NO3/c14-11-8(13(15,16)17)2-1-3-9(11)21-10-6-7(12(19)20)4-5-18-10/h1-6H,(H,19,20)

InChI key: InChIKey=ZXGLVBTWPAHNNP-UHFFFAOYSA-N

SMILES: O(C1=C(F)C(C(F)(F)F)=CC=C1)C2=CC(C(O)=O)=CC=N2

Synonyms:

• 4-Pyridinecarboxylic acid, 2-[2-fluoro-3-(trifluoromethyl)phenoxy]-
• 2-[2-Fluoro-3-(trifluoromethyl)phenoxy]-4-pyridinecarboxylic acid
• 2-[2-fluoro-3-(trifluoromethyl)phenoxy]isonicotinic acid
• 4-pyridinecarboxylic acid, 2-[2-fluoro-3-(trifluoromethyl)