CymitQuimica logo

CAS 1160264-57-2

:

5-[2-Chloro-3-(trifluoromethyl)phenoxy]-2-furancarboxylic acid

Description:
5-[2-Chloro-3-(trifluoromethyl)phenoxy]-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a phenoxy group substituted with a chlorine atom and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The trifluoromethyl group often imparts lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical and agrochemical research. The presence of the carboxylic acid functional group suggests potential for hydrogen bonding and solubility in polar solvents. Additionally, the chlorine substituent can enhance the compound's reactivity and may affect its interaction with biological targets. Overall, this compound's characteristics make it a subject of interest for further studies in medicinal chemistry and material science, particularly in the development of new therapeutic agents or agrochemicals.
Formula:C12H6ClF3O4
InChI:InChI=1S/C12H6ClF3O4/c13-10-6(12(14,15)16)2-1-3-7(10)19-9-5-4-8(20-9)11(17)18/h1-5H,(H,17,18)
InChI key:InChIKey=JGBBEDOGDOMTJG-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C(C(F)(F)F)=CC=C1)C=2OC(C(O)=O)=CC2
Synonyms:
  • 5-[2-Chloro-3-(trifluoromethyl)phenoxy]-2-furancarboxylic acid
  • 2-Furancarboxylic acid, 5-[2-chloro-3-(trifluoromethyl)phenoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.