CAS 1160264-58-3
:2-(2,3-Dimethoxyphenoxy)-3-pyridinecarboxylic acid
Description:
2-(2,3-Dimethoxyphenoxy)-3-pyridinecarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenoxy group with two methoxy substituents. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in different solvents. The methoxy groups can enhance the compound's lipophilicity and may also affect its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques like NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Overall, 2-(2,3-Dimethoxyphenoxy)-3-pyridinecarboxylic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C14H13NO5
InChI:InChI=1S/C14H13NO5/c1-18-10-6-3-7-11(12(10)19-2)20-13-9(14(16)17)5-4-8-15-13/h3-8H,1-2H3,(H,16,17)
InChI key:InChIKey=NNJPKEDZLAKOKB-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC2=C(C(O)=O)C=CC=N2)C=CC=C1OC
Synonyms:- 3-Pyridinecarboxylic acid, 2-(2,3-dimethoxyphenoxy)-
- 2-(2,3-Dimethoxyphenoxy)-3-pyridinecarboxylic acid
- 2-(2,3-dimethoxyphenoxy)nicotinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.