CAS 1160264-59-4

2-(4-Propylphenoxy)-3-pyridinecarboxylic acid

Description:

2-(4-Propylphenoxy)-3-pyridinecarboxylic acid, identified by its CAS number 1160264-59-4, is an organic compound characterized by its unique structural features. It consists of a pyridine ring substituted with a carboxylic acid group and a propylphenoxy moiety. This compound exhibits properties typical of both aromatic and heterocyclic compounds, which may influence its solubility, reactivity, and potential biological activity. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, while the aromatic rings contribute to its stability and potential for π-π interactions. Additionally, the propyl group may enhance lipophilicity, affecting its distribution in biological systems. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Understanding its characteristics, including melting point, boiling point, and spectral properties, would require specific experimental data or literature references. Overall, this compound's structural complexity suggests a range of possible interactions and applications in various chemical contexts.

Formula: C₁₅H₁₅NO₃

InChI: InChI=1S/C15H15NO3/c1-2-4-11-6-8-12(9-7-11)19-14-13(15(17)18)5-3-10-16-14/h3,5-10H,2,4H2,1H3,(H,17,18)

InChI key: InChIKey=DPQXGFHFZQUMTA-UHFFFAOYSA-N

SMILES: O(C1=C(C(O)=O)C=CC=N1)C2=CC=C(CCC)C=C2

Synonyms:

• 2-(4-Propylphenoxy)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 2-(4-propylphenoxy)-