CAS 1160264-60-7

2-(3-Methoxyphenyl)-4-quinolinecarbonyl chloride

Description:

2-(3-Methoxyphenyl)-4-quinolinecarbonyl chloride, identified by its CAS number 1160264-60-7, is a chemical compound that features a quinoline moiety substituted with a methoxyphenyl group and a carbonyl chloride functional group. This compound is characterized by its aromatic structure, which contributes to its potential reactivity and interactions in various chemical environments. The presence of the carbonyl chloride group indicates that it can participate in nucleophilic acyl substitution reactions, making it useful in organic synthesis, particularly in the formation of amides or esters. The methoxy group enhances the compound's solubility in organic solvents and may influence its electronic properties, potentially affecting its reactivity and biological activity. Additionally, the quinoline structure is known for its pharmacological significance, often being associated with various biological activities, including antimicrobial and antimalarial properties. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and materials science.

Formula: C₁₇H₁₂ClNO₂

InChI: InChI=1S/C17H12ClNO2/c1-21-12-6-4-5-11(9-12)16-10-14(17(18)20)13-7-2-3-8-15(13)19-16/h2-10H,1H3

InChI key: InChIKey=JAYVAQQJRIZFKU-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OC)=CC=C3)C=CC=C2

Synonyms:

• 2-(3-Methoxyphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(3-methoxyphenyl)-