CAS 1160264-63-0
:2-(4-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride
Description:
2-(4-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system substituted with a methoxyphenyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The methoxy group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the quinoline moiety is often associated with various pharmacological properties, including antimicrobial and antitumor activities. The compound's synthesis and handling require careful consideration due to the reactivity of the carbonyl chloride, which can release hydrochloric acid upon hydrolysis. Overall, this compound represents a class of organic molecules that may have significant applications in drug development and chemical synthesis.
Formula:C18H14ClNO2
InChI:InChI=1S/C18H14ClNO2/c1-11-3-8-16-14(9-11)15(18(19)21)10-17(20-16)12-4-6-13(22-2)7-5-12/h3-10H,1-2H3
InChI key:InChIKey=UUGWRILBSRYAQR-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OC)C=C3)C=CC(C)=C2
Synonyms:- 2-(4-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-(4-methoxyphenyl)-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.