CAS 1160264-68-5
:2-[3-(1-Methylethoxy)phenyl]-4-quinolinecarbonyl chloride
Description:
2-[3-(1-Methylethoxy)phenyl]-4-quinolinecarbonyl chloride, identified by its CAS number 1160264-68-5, is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features a phenyl ring substituted with a 1-methylethoxy group, contributing to its unique reactivity and solubility properties. The presence of the carbonyl chloride group indicates that it can participate in nucleophilic acyl substitution reactions, making it a useful intermediate in organic synthesis. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functionalities are often exploited. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and solvent choice. Safety considerations are paramount when handling this substance, as carbonyl chlorides can be hazardous, requiring appropriate safety measures to mitigate risks associated with exposure. Overall, this compound exemplifies the intricate interplay of functional groups in organic chemistry, highlighting its potential utility in various chemical applications.
Formula:C19H16ClNO2
InChI:InChI=1S/C19H16ClNO2/c1-12(2)23-14-7-5-6-13(10-14)18-11-16(19(20)22)15-8-3-4-9-17(15)21-18/h3-12H,1-2H3
InChI key:InChIKey=PBOWAROGKKRRDV-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=CC(=NC2=C1C=CC=C2)C3=CC(OC(C)C)=CC=C3
Synonyms:- 2-[3-(1-Methylethoxy)phenyl]-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-[3-(1-methylethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.