CAS 1160264-69-6

2-[3-(2-Methylpropoxy)phenyl]-4-quinolinecarbonyl chloride

Description:

2-[3-(2-Methylpropoxy)phenyl]-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features a phenyl ring substituted with a 2-methylpropoxy group, contributing to its hydrophobic properties. The presence of the carbonyl chloride functional group indicates that it can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. The quinoline structure is known for its biological activity, often exhibiting antimicrobial and antitumor properties. Additionally, the compound's molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific reactivity and interactions would depend on the surrounding conditions, such as solvent and temperature. Overall, this compound represents a class of organic molecules that are of interest in both synthetic and medicinal chemistry due to their diverse functional groups and potential biological activities.

Formula: C₂₀H₁₈ClNO₂

InChI: InChI=1S/C20H18ClNO2/c1-13(2)12-24-15-7-5-6-14(10-15)19-11-17(20(21)23)16-8-3-4-9-18(16)22-19/h3-11,13H,12H2,1-2H3

InChI key: InChIKey=OSYCGLLFZWSYPK-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCC(C)C)=CC=C3)C=CC=C2

Synonyms:

• 2-[3-(2-Methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-[3-(2-methylpropoxy)phenyl]-