CAS 1160264-70-9

2-(3-Methylphenyl)-4-quinolinecarbonyl chloride

Description:

2-(3-Methylphenyl)-4-quinolinecarbonyl chloride, identified by its CAS number 1160264-70-9, is a chemical compound that features a quinoline moiety, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. This compound is characterized by the presence of a carbonyl chloride functional group, indicating that it is an acyl chloride, which is known for its reactivity, particularly in nucleophilic acyl substitution reactions. The 3-methylphenyl substituent contributes to its aromatic character and may influence its solubility and reactivity. Typically, compounds of this nature are utilized in organic synthesis, particularly in the preparation of various derivatives through reactions with nucleophiles. The presence of the carbonyl chloride group makes it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular structure and the interactions between its functional groups. Safety precautions are essential when handling this compound due to the potential hazards associated with acyl chlorides.

Formula: C₁₇H₁₂ClNO

InChI: InChI=1S/C17H12ClNO/c1-11-5-4-6-12(9-11)16-10-14(17(18)20)13-7-2-3-8-15(13)19-16/h2-10H,1H3

InChI key: InChIKey=KFJMMUKVLNOTDN-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(C)=CC=C3)C=CC=C2

Synonyms:

• 2-(3-Methylphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(3-methylphenyl)-
• 2-(3-methylphenyl)quinoline-4-carbonyl chloride