CAS 1160264-71-0
:2-(3,4-Dimethylphenyl)-4-quinolinecarbonyl chloride
Description:
2-(3,4-Dimethylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and carbonyl functionalities, making it a potential candidate for various chemical reactions, particularly in organic synthesis. The presence of the dimethylphenyl group contributes to its hydrophobic characteristics, while the carbonyl chloride group can act as a reactive site for nucleophilic substitution reactions. This compound may be utilized in the synthesis of more complex organic molecules, including pharmaceuticals and agrochemicals, due to its ability to participate in acylation reactions. Additionally, its stability and reactivity can be influenced by factors such as temperature and solvent choice. As with many chlorinated compounds, appropriate safety measures should be taken when handling it, as it may pose health risks and environmental concerns. Overall, 2-(3,4-Dimethylphenyl)-4-quinolinecarbonyl chloride represents a versatile building block in synthetic organic chemistry.
Formula:C18H14ClNO
InChI:InChI=1S/C18H14ClNO/c1-11-7-8-13(9-12(11)2)17-10-15(18(19)21)14-5-3-4-6-16(14)20-17/h3-10H,1-2H3
InChI key:InChIKey=LZRISFCHGXWGFP-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=CC(=NC2=C1C=CC=C2)C3=CC(C)=C(C)C=C3
Synonyms:- 2-(3,4-Dimethylphenyl)-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-(3,4-dimethylphenyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery