CAS 1160264-72-1

2-(2,5-Dimethylphenyl)-4-quinolinecarbonyl chloride

Description:

2-(2,5-Dimethylphenyl)-4-quinolinecarbonyl chloride is an organic compound characterized by its unique structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features a quinoline ring system, known for its aromatic properties and potential biological activity, combined with a carbonyl chloride group that makes it reactive, particularly in nucleophilic substitution reactions. The presence of the 2,5-dimethylphenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds like this can be utilized in various applications, including pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The carbonyl chloride functionality suggests that it can participate in acylation reactions, making it valuable in the synthesis of more complex molecules. Safety considerations are important when handling this compound due to the reactivity of the carbonyl chloride group, which can release hydrochloric acid upon hydrolysis. Overall, this compound exemplifies the intersection of aromatic chemistry and functional group reactivity, making it a subject of interest in synthetic organic chemistry.

Formula: C₁₈H₁₄ClNO

InChI: InChI=1S/C18H14ClNO/c1-11-7-8-12(2)14(9-11)17-10-15(18(19)21)13-5-3-4-6-16(13)20-17/h3-10H,1-2H3

InChI key: InChIKey=PLRPMBXWWFXNFY-UHFFFAOYSA-N

SMILES: CC1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=CC=C3)C=C(C)C=C1

Synonyms:

• 2-(2,5-Dimethylphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(2,5-dimethylphenyl)-