CAS 1160264-76-5

2-(3-Ethoxyphenyl)-4-quinolinecarbonyl chloride

Description:

2-(3-Ethoxyphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which combines a quinoline moiety with an ethoxy-substituted phenyl group. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, particularly in acylation processes. The presence of the ethoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Typically, compounds of this nature are of interest in medicinal chemistry and organic synthesis due to their potential applications in drug development and as intermediates in the synthesis of more complex molecules. The compound's reactivity, particularly as an acyl chloride, allows it to readily react with amines, alcohols, and other nucleophiles, facilitating the formation of diverse derivatives. Safety considerations should be taken into account when handling this compound, as acyl chlorides can be corrosive and may release hydrochloric acid upon reaction with moisture.

Formula: C₁₈H₁₄ClNO₂

InChI: InChI=1S/C18H14ClNO2/c1-2-22-13-7-5-6-12(10-13)17-11-15(18(19)21)14-8-3-4-9-16(14)20-17/h3-11H,2H2,1H3

InChI key: InChIKey=SXGQAUBELUPTFY-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1=CC(=NC2=C1C=CC=C2)C3=CC(OCC)=CC=C3

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(3-ethoxyphenyl)-
• 2-(3-Ethoxyphenyl)-4-quinolinecarbonyl chloride