CAS 1160264-77-6: 2-(2-Ethoxyphenyl)-4-quinolinecarbonyl chloride

Description: 2-(2-Ethoxyphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which combines a quinoline moiety with an ethoxy-substituted phenyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and halogenated compounds, including potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The ethoxy group may influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the quinoline structure can impart biological activity, as many quinoline derivatives are known for their pharmacological properties. The compound's reactivity and stability can be affected by environmental conditions such as temperature and moisture. Overall, 2-(2-Ethoxyphenyl)-4-quinolinecarbonyl chloride is of interest in synthetic organic chemistry and may have applications in medicinal chemistry or material science, depending on its specific reactivity and functionalization potential.

Formula: C₁₈H₁₄ClNO₂

InChI: InChI=1S/C18H14ClNO2/c1-2-22-17-10-6-4-8-13(17)16-11-14(18(19)21)12-7-3-5-9-15(12)20-16/h3-11H,2H2,1H3

InChI key: InChIKey=AXHZRMDYCNVONK-UHFFFAOYSA-N

SMILES: O=C(Cl)C1=CC(=NC=2C=CC=CC21)C=3C=CC=CC3OCC

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(2-ethoxyphenyl)-
• 2-(2-Ethoxyphenyl)-4-quinolinecarbonyl chloride

2-(2-ethoxyphenyl)quinoline-4-carbonyl chloride

CAS: 1160264-77-6

• Molecular weight: 311.7699890136719

2-(2-Ethoxyphenyl)quinoline-4-carbonyl chloride

CAS: 1160264-77-6

Please enquire for more information about 2-(2-Ethoxyphenyl)quinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₁₈H₁₄ClNO₂
• Purity: Min. 95%
• Molecular weight: 311.76 g/mol