CymitQuimica logo

CAS 1160264-78-7

:

2-[4-(1,1-Dimethylethyl)phenyl]-4-quinolinecarbonyl chloride

Description:
2-[4-(1,1-Dimethylethyl)phenyl]-4-quinolinecarbonyl chloride, identified by its CAS number 1160264-78-7, is a chemical compound characterized by its unique structure that combines a quinoline moiety with a carbonyl chloride functional group. This compound features a bulky tert-butyl group attached to a phenyl ring, which contributes to its steric properties and may influence its reactivity and solubility. The presence of the carbonyl chloride functional group indicates that it can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. Additionally, the quinoline structure is known for its biological activity, which may suggest potential applications in pharmaceuticals or agrochemicals. The compound is likely to be a solid at room temperature, with specific melting and boiling points dependent on its purity and crystalline form. Safety precautions should be taken when handling this compound, as carbonyl chlorides can be reactive and potentially hazardous. Overall, its unique structural features make it a compound of interest in various chemical research fields.
Formula:C20H18ClNO
InChI:InChI=1S/C20H18ClNO/c1-20(2,3)14-10-8-13(9-11-14)18-12-16(19(21)23)15-6-4-5-7-17(15)22-18/h4-12H,1-3H3
InChI key:InChIKey=BOPIFAQPNKCIPO-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(C)(C)C)C=C3)C=CC=C2
Synonyms:
  • 2-[4-(1,1-Dimethylethyl)phenyl]-4-quinolinecarbonyl chloride
  • 4-Quinolinecarbonyl chloride, 2-[4-(1,1-dimethylethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.