CAS 1160264-79-8

2-(4-Propoxyphenyl)-4-quinolinecarbonyl chloride

Description:

2-(4-Propoxyphenyl)-4-quinolinecarbonyl chloride, identified by its CAS number 1160264-79-8, is a chemical compound that features a quinoline core substituted with a propoxyphenyl group and a carbonyl chloride functional group. This compound is characterized by its aromatic structure, which contributes to its potential reactivity and stability under various conditions. The presence of the carbonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it useful in organic synthesis, particularly in the formation of amides or esters. The propoxyphenyl substituent may influence the compound's solubility and interaction with biological systems, suggesting potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's molecular structure may exhibit specific optical properties, which could be relevant in materials science or dye applications. As with many chlorinated compounds, appropriate safety measures should be taken when handling this substance due to its potential reactivity and toxicity.

Formula: C₁₉H₁₆ClNO₂

InChI: InChI=1S/C19H16ClNO2/c1-2-11-23-14-9-7-13(8-10-14)18-12-16(19(20)22)15-5-3-4-6-17(15)21-18/h3-10,12H,2,11H2,1H3

InChI key: InChIKey=NUDOFDDUEPICHD-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCCC)C=C3)C=CC=C2

Synonyms:

• 2-(4-Propoxyphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(4-propoxyphenyl)-