CAS 1160264-80-1
:2-(3-Propoxyphenyl)-4-quinolinecarbonyl chloride
Description:
2-(3-Propoxyphenyl)-4-quinolinecarbonyl chloride, identified by its CAS number 1160264-80-1, is a chemical compound characterized by its unique structural features, which include a quinoline moiety and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and halogenated compounds, such as moderate to high stability under standard conditions, and potential reactivity due to the presence of the carbonyl chloride group, which can participate in nucleophilic substitution reactions. The propoxyphenyl group contributes to its lipophilicity, potentially influencing its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and handling require careful consideration of safety protocols due to the reactive nature of the carbonyl chloride functional group, which can release hydrochloric acid upon hydrolysis. Overall, this compound's characteristics make it a valuable subject for further study in organic chemistry and medicinal applications.
Formula:C19H16ClNO2
InChI:InChI=1S/C19H16ClNO2/c1-2-10-23-14-7-5-6-13(11-14)18-12-16(19(20)22)15-8-3-4-9-17(15)21-18/h3-9,11-12H,2,10H2,1H3
InChI key:InChIKey=UDRPBQSJNXJZBH-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCCC)=CC=C3)C=CC=C2
Synonyms:- 2-(3-Propoxyphenyl)-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-(3-propoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.