CAS 1160264-82-3
:2-[2-(1-Methylethoxy)phenyl]-4-quinolinecarbonyl chloride
Description:
2-[2-(1-Methylethoxy)phenyl]-4-quinolinecarbonyl chloride, identified by its CAS number 1160264-82-3, is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and halogenated compounds, such as potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The presence of the methylethoxy group suggests that it may have moderate lipophilicity, influencing its solubility in organic solvents. Additionally, the quinoline structure may impart biological activity, making it of interest in medicinal chemistry. The compound's stability, reactivity, and potential applications would depend on its specific functional groups and overall molecular architecture. As with many chlorinated compounds, it may also pose environmental and health risks, necessitating careful handling and consideration in research and industrial applications.
Formula:C19H16ClNO2
InChI:InChI=1S/C19H16ClNO2/c1-12(2)23-18-10-6-4-8-14(18)17-11-15(19(20)22)13-7-3-5-9-16(13)21-17/h3-12H,1-2H3
InChI key:InChIKey=JADABIOMKUOMJN-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=C(C=CC=C1)C2=NC3=C(C(C(Cl)=O)=C2)C=CC=C3
Synonyms:- 4-Quinolinecarbonyl chloride, 2-[2-(1-methylethoxy)phenyl]-
- 2-[2-(1-Methylethoxy)phenyl]-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.