CAS 1160264-84-5
:2-[4-(2-Methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
Description:
2-[4-(2-Methylpropoxy)phenyl]-4-quinolinecarbonyl chloride, identified by its CAS number 1160264-84-5, is a chemical compound characterized by its unique structure that combines a quinoline moiety with a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the carbonyl chloride group suggests it may participate in nucleophilic substitution reactions, making it useful in organic synthesis. Additionally, the 2-methylpropoxy group enhances its solubility in organic solvents, which can be advantageous for various applications in chemical reactions or formulations. The compound's molecular structure may also impart specific biological activities, making it of interest in pharmaceutical research. Overall, its characteristics, including reactivity, solubility, and potential biological activity, position it as a valuable compound in both synthetic and medicinal chemistry contexts.
Formula:C20H18ClNO2
InChI:InChI=1S/C20H18ClNO2/c1-13(2)12-24-15-9-7-14(8-10-15)19-11-17(20(21)23)16-5-3-4-6-18(16)22-19/h3-11,13H,12H2,1-2H3
InChI key:InChIKey=QQJZYARCNPUYQI-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC(C)C)C=C3)C=CC=C2
Synonyms:- 2-[4-(2-Methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-[4-(2-methylpropoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.