CAS 1160264-85-6

2-(3-Butoxyphenyl)-4-quinolinecarbonyl chloride

Description:

2-(3-Butoxyphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a butoxyphenyl group. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its reactivity due to the presence of the carbonyl chloride functional group, which can participate in nucleophilic substitution reactions. The butoxyphenyl group contributes to its hydrophobic characteristics, potentially influencing its solubility in organic solvents. This compound may be utilized in various applications, including organic synthesis and medicinal chemistry, where it could serve as an intermediate in the development of pharmaceuticals or agrochemicals. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and specific conditions under which it is studied. As with many chemical substances, handling precautions should be observed due to potential reactivity and toxicity associated with the carbonyl chloride functional group.

Formula: C₂₀H₁₈ClNO₂

InChI: InChI=1S/C20H18ClNO2/c1-2-3-11-24-15-8-6-7-14(12-15)19-13-17(20(21)23)16-9-4-5-10-18(16)22-19/h4-10,12-13H,2-3,11H2,1H3

InChI key: InChIKey=ZOQMSNIBORRGJD-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCCCC)=CC=C3)C=CC=C2

Synonyms:

• 2-(3-Butoxyphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(3-butoxyphenyl)-