CAS 1160264-87-8
:2-(2,5-Dimethoxyphenyl)-4-quinolinecarbonyl chloride
Description:
2-(2,5-Dimethoxyphenyl)-4-quinolinecarbonyl chloride, identified by its CAS number 1160264-87-8, is a chemical compound that features a quinoline moiety substituted with a carbonyl chloride group and a dimethoxyphenyl group. This compound is characterized by its complex aromatic structure, which contributes to its potential reactivity and applications in organic synthesis. The presence of the carbonyl chloride functional group indicates that it can participate in acylation reactions, making it useful in the synthesis of various derivatives. The dimethoxy substituents on the phenyl ring can influence the compound's electronic properties and solubility, potentially enhancing its reactivity towards nucleophiles. Additionally, the quinoline structure is known for its biological activity, which may suggest potential pharmaceutical applications. Overall, this compound's unique structural features and functional groups make it a subject of interest in both synthetic organic chemistry and medicinal chemistry research.
Formula:C18H14ClNO3
InChI:InChI=1S/C18H14ClNO3/c1-22-11-7-8-17(23-2)14(9-11)16-10-13(18(19)21)12-5-3-4-6-15(12)20-16/h3-10H,1-2H3
InChI key:InChIKey=TUCAZCDGBFOWDT-UHFFFAOYSA-N
SMILES:O(C)C1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=CC=C3)C=C(OC)C=C1
Synonyms:- 2-(2,5-Dimethoxyphenyl)-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-(2,5-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.