CAS 1160264-89-0
:2-(5-Ethyl-2-thienyl)-4-quinolinecarbonyl chloride
Description:
2-(5-Ethyl-2-thienyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a thienyl group. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride. The presence of the ethyl substituent on the thienyl ring contributes to its hydrophobic characteristics, while the quinoline structure imparts aromaticity and potential biological activity. The compound is likely to be used in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its ability to participate in acylation reactions. Its reactivity as an acyl chloride allows for the introduction of various functional groups, making it a versatile intermediate in chemical synthesis. Additionally, the presence of heteroatoms in the thienyl and quinoline rings may influence its solubility and interaction with biological targets. Safety precautions should be taken when handling this compound, as acyl chlorides can be corrosive and may release harmful gases upon reaction with water or alcohols.
Formula:C16H12ClNOS
InChI:InChI=1S/C16H12ClNOS/c1-2-10-7-8-15(20-10)14-9-12(16(17)19)11-5-3-4-6-13(11)18-14/h3-9H,2H2,1H3
InChI key:InChIKey=MBXSSBGCMOHIRL-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C=3SC(CC)=CC3)C=CC=C2
Synonyms:- 2-(5-Ethyl-2-thienyl)-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-(5-ethyl-2-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.