CAS 1160264-90-3

2-(5-Chloro-2-thienyl)-4-quinolinecarbonyl chloride

Description:

2-(5-Chloro-2-thienyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a thienyl group. The presence of the chloro substituent on the thienyl ring enhances its reactivity, making it a valuable intermediate in organic synthesis. This compound features a carbonyl chloride functional group, which is known for its ability to participate in acylation reactions, allowing for the introduction of various functional groups. The compound is typically used in the synthesis of pharmaceuticals and agrochemicals due to its potential biological activity. Its reactivity and structural features suggest that it may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would require further investigation. As with many chlorinated compounds, appropriate safety measures should be taken during handling, as it may pose risks such as toxicity or environmental hazards. Overall, 2-(5-Chloro-2-thienyl)-4-quinolinecarbonyl chloride is an important compound in the field of synthetic organic chemistry.

Formula: C₁₄H₇Cl₂NOS

InChI: InChI=1S/C14H7Cl2NOS/c15-13-6-5-12(19-13)11-7-9(14(16)18)8-3-1-2-4-10(8)17-11/h1-7H

InChI key: InChIKey=TXJFAGRDZKPZGA-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C=3SC(Cl)=CC3)C=CC=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(5-chloro-2-thienyl)-
• 2-(5-Chloro-2-thienyl)-4-quinolinecarbonyl chloride