CAS 1160264-92-5
:2-(5-Methyl-2-furanyl)-4-quinolinecarbonyl chloride
Description:
2-(5-Methyl-2-furanyl)-4-quinolinecarbonyl chloride, with the CAS number 1160264-92-5, is a chemical compound characterized by its unique structural features that combine a quinoline moiety with a furan ring. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential reactivity due to the presence of the carbonyl chloride functional group. The furan ring contributes to its electron-rich character, while the quinoline structure may impart biological activity, making it of interest in medicinal chemistry. The carbonyl chloride group is a reactive electrophile, which can participate in nucleophilic substitution reactions, making this compound useful in synthetic organic chemistry. Additionally, the presence of the methyl group on the furan ring can influence the compound's solubility and reactivity. Overall, this compound's unique combination of functional groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. However, specific safety and handling precautions should be observed due to the reactivity of the carbonyl chloride group.
Formula:C15H10ClNO2
InChI:InChI=1S/C15H10ClNO2/c1-9-6-7-14(19-9)13-8-11(15(16)18)10-4-2-3-5-12(10)17-13/h2-8H,1H3
InChI key:InChIKey=LHFBENHCOAVYAR-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C=3OC(C)=CC3)C=CC=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(5-methyl-2-furanyl)-
- 2-(5-Methyl-2-furanyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.