CAS 1160264-93-6
:3-Methyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride
Description:
3-Methyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The methyl groups on the quinoline and phenyl rings contribute to its lipophilicity, potentially influencing its solubility in organic solvents. Additionally, the presence of the carbonyl chloride functional group suggests that it may be reactive towards nucleophiles, making it useful in various synthetic applications, including the formation of amides or esters. The compound's molecular structure may also impart specific biological activities, which could be of interest in medicinal chemistry. Overall, 3-Methyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride is a versatile compound with potential applications in organic synthesis and pharmaceuticals.
Formula:C18H14ClNO
InChI:InChI=1S/C18H14ClNO/c1-11-7-9-13(10-8-11)17-12(2)16(18(19)21)14-5-3-4-6-15(14)20-17/h3-10H,1-2H3
InChI key:InChIKey=MBXXAKLQDSASDQ-UHFFFAOYSA-N
SMILES:CC=1C(=NC2=C(C1C(Cl)=O)C=CC=C2)C3=CC=C(C)C=C3
Synonyms:- 4-Quinolinecarbonyl chloride, 3-methyl-2-(4-methylphenyl)-
- 3-Methyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride
- 3-methyl-2-(4-methylphenyl)quinoline-4-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.