CAS 1160264-94-7

2-(4-Methoxyphenyl)-3-methyl-4-quinolinecarbonyl chloride

Description:

2-(4-Methoxyphenyl)-3-methyl-4-quinolinecarbonyl chloride, with the CAS number 1160264-94-7, is a chemical compound characterized by its unique structure that combines a quinoline moiety with a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and halogenated compounds, including potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The methoxy group on the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. Additionally, the presence of the methyl group on the quinoline ring may affect steric hindrance and overall molecular stability. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthetic pathways. Safety considerations should be taken into account when handling this compound, as carbonyl chlorides can be corrosive and toxic.

Formula: C₁₈H₁₄ClNO₂

InChI: InChI=1S/C18H14ClNO2/c1-11-16(18(19)21)14-5-3-4-6-15(14)20-17(11)12-7-9-13(22-2)10-8-12/h3-10H,1-2H3

InChI key: InChIKey=DYXHPXFIPGZQKT-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1C)C3=CC=C(OC)C=C3)C=CC=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(4-methoxyphenyl)-3-methyl-
• 2-(4-Methoxyphenyl)-3-methyl-4-quinolinecarbonyl chloride