CAS 1160264-95-8
:2-(4-Chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride
Description:
2-(4-Chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride, identified by its CAS number 1160264-95-8, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline ring system, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of a 4-chlorophenyl group indicates that there is a chlorine substituent on the phenyl ring, which can influence the compound's reactivity and biological activity. The carbonyl chloride functional group suggests that it can act as an acyl chloride, making it reactive towards nucleophiles, which is significant in synthetic organic chemistry. The methyl group at the 3-position of the quinoline ring may also affect the compound's sterics and electronic properties. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific applications and biological activities would require further investigation and research.
Formula:C17H11Cl2NO
InChI:InChI=1S/C17H11Cl2NO/c1-10-15(17(19)21)13-4-2-3-5-14(13)20-16(10)11-6-8-12(18)9-7-11/h2-9H,1H3
InChI key:InChIKey=OFSZQPMIOWCWIF-UHFFFAOYSA-N
SMILES:CC=1C(=NC2=C(C1C(Cl)=O)C=CC=C2)C3=CC=C(Cl)C=C3
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(4-chlorophenyl)-3-methyl-
- 2-(4-Chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.