CAS 1160264-96-9: 2-(3-Chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride
Description:2-(3-Chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a chlorophenyl group. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased reactivity due to the presence of the chlorine atom. It is likely to be a solid at room temperature, with potential applications in organic synthesis, pharmaceuticals, or agrochemicals, given the presence of functional groups that can participate in further chemical reactions. The carbonyl chloride functional group suggests that it may act as an acylating agent, making it useful in the synthesis of various derivatives. Additionally, the compound's molecular structure may impart specific biological activities, which could be of interest in medicinal chemistry. However, handling precautions should be observed due to the potential toxicity and reactivity of the chlorinated and acyl chloride functionalities. As with all chemical substances, proper safety measures and regulatory compliance are essential when working with this compound.
Formula:C17H11Cl2NO
InChI:InChI=1S/C17H11Cl2NO/c1-10-15(17(19)21)13-7-2-3-8-14(13)20-16(10)11-5-4-6-12(18)9-11/h2-9H,1H3
InChI key:InChIKey=NVWVGFLTFZVJCG-UHFFFAOYSA-N
SMILES:O=C(Cl)C=1C=2C=CC=CC2N=C(C=3C=CC=C(Cl)C3)C1C
- Synonyms:
- 4-Quinolinecarbonyl chloride, 2-(3-chlorophenyl)-3-methyl-
- 2-(3-Chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(3-chlorophenyl)-3-methylquinoline-4-carbonyl chloride REF: 10-F368360CAS: 1160264-96-9 | - - - | - - - | Discontinued product |
![]() | 2-(3-Chlorophenyl)-3-methylquinoline-4-carbonyl chloride REF: 3D-FC120677CAS: 1160264-96-9 | Min. 95% | - - - | Discontinued product |

2-(3-chlorophenyl)-3-methylquinoline-4-carbonyl chloride
Ref: 10-F368360
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

2-(3-Chlorophenyl)-3-methylquinoline-4-carbonyl chloride
Ref: 3D-FC120677
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |