CAS 1160264-97-0
:2-(2,4-Dichlorophenyl)-3-methyl-4-quinolinecarbonyl chloride
Description:
2-(2,4-Dichlorophenyl)-3-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased lipophilicity and potential biological activity. The presence of the dichlorophenyl group may enhance its reactivity and influence its interaction with biological targets. As a carbonyl chloride, it is likely to be reactive, particularly with nucleophiles, making it useful in various synthetic applications. The compound may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization. Additionally, due to its structural features, it may possess potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Safety precautions should be taken when handling this compound, as carbonyl chlorides can be hazardous.
Formula:C17H10Cl3NO
InChI:InChI=1S/C17H10Cl3NO/c1-9-15(17(20)22)12-4-2-3-5-14(12)21-16(9)11-7-6-10(18)8-13(11)19/h2-8H,1H3
InChI key:InChIKey=AUNAETBMLGITNU-UHFFFAOYSA-N
SMILES:CC=1C(=NC2=C(C1C(Cl)=O)C=CC=C2)C3=C(Cl)C=C(Cl)C=C3
Synonyms:- 2-(2,4-Dichlorophenyl)-3-methyl-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-(2,4-dichlorophenyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.