CAS 1160264-99-2: 6-Bromo-2-(4-methylphenyl)-4-quinolinecarbonyl chloride

Description: 6-Bromo-2-(4-methylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system substituted with a bromine atom and a 4-methylphenyl group. This compound features a carbonyl chloride functional group, which makes it reactive, particularly in nucleophilic substitution reactions. The presence of the bromine atom enhances its electrophilic character, allowing for further functionalization. The 4-methylphenyl substituent contributes to the compound's hydrophobic properties, influencing its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Additionally, the presence of the carbonyl chloride group suggests potential applications in organic synthesis, where it can serve as an acylating agent. Overall, the compound's structural characteristics suggest a versatile reactivity profile, making it a valuable intermediate in various chemical reactions and applications.

Formula: C₁₇H₁₁BrClNO

InChI: InChI=1S/C17H11BrClNO/c1-10-2-4-11(5-3-10)16-9-14(17(19)21)13-8-12(18)6-7-15(13)20-16/h2-9H,1H3

InChI key: InChIKey=FQIUEYXETREWMR-UHFFFAOYSA-N

SMILES: O=C(Cl)C1=CC(=NC=2C=CC(Br)=CC21)C=3C=CC(=CC3)C

Synonyms:

• 4-Quinolinecarbonyl chloride, 6-bromo-2-(4-methylphenyl)-
• 6-Bromo-2-(4-methylphenyl)-4-quinolinecarbonyl chloride

6-bromo-2-(4-methylphenyl)quinoline-4-carbonyl chloride

CAS: 1160264-99-2

• Molecular weight: 360.6400146484375

6-Bromo-2-(4-methylphenyl)quinoline-4-carbonyl chloride

CAS: 1160264-99-2

Please enquire for more information about 6-Bromo-2-(4-methylphenyl)quinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₁₇H₁₁BrClNO
• Purity: Min. 95%
• Molecular weight: 360.63 g/mol