CAS 1160265-01-9
:6-Bromo-2-(5-methyl-2-furanyl)-4-quinolinecarbonyl chloride
Description:
6-Bromo-2-(5-methyl-2-furanyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline ring, a bromine atom, and a furan moiety. The presence of the bromine atom suggests potential reactivity, particularly in electrophilic substitution reactions. The quinoline core contributes to its aromatic properties and may influence its biological activity, making it of interest in medicinal chemistry. The carbonyl chloride functional group indicates that this compound can participate in acylation reactions, potentially serving as an acylating agent in organic synthesis. Additionally, the furan ring, known for its heterocyclic nature, may impart unique electronic properties and reactivity patterns. Overall, this compound's structural features suggest it could be explored for various applications, including pharmaceuticals and agrochemicals, although specific biological activities or applications would require further investigation. Safety and handling precautions should be observed due to the presence of reactive functional groups.
Formula:C15H9BrClNO2
InChI:InChI=1S/C15H9BrClNO2/c1-8-2-5-14(20-8)13-7-11(15(17)19)10-6-9(16)3-4-12(10)18-13/h2-7H,1H3
InChI key:InChIKey=VZERTSYNEYUFST-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C)O3)C=CC(Br)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6-bromo-2-(5-methyl-2-furanyl)-
- 6-Bromo-2-(5-methyl-2-furanyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.