CAS 116040-91-6

1H-Benzimidazole-2-propanol,1-methyl-(9CI)

Description:

1H-Benzimidazole-2-propanol, 1-methyl- (9CI), with the CAS number 116040-91-6, is a chemical compound characterized by its benzimidazole core structure, which is a bicyclic compound containing a fused benzene and imidazole ring. This substance typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity. It is often recognized for its role in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the propanol and methyl groups contributes to its solubility and reactivity, making it a versatile compound in various chemical reactions. Additionally, it may exhibit specific functional properties such as antioxidant or antimicrobial activities, depending on its structural modifications and substituents. Safety and handling considerations are essential, as with any chemical, and it is advisable to consult material safety data sheets (MSDS) for detailed information regarding toxicity and safe usage.

Formula: C₁₁H₁₄N₂O

InChI: InChI=1/C11H14N2O/c1-13-10-6-3-2-5-9(10)12-11(13)7-4-8-14/h2-3,5-6,14H,4,7-8H2,1H3

SMILES: Cn1c2ccccc2nc1CCCO

Synonyms:

• 1H-Benzimidazole-2-propanol, 1-methyl-
• 3-(1-Methyl-1H-benzimidazol-2-yl)propan-1-ol

3-(1-Methyl-1H-benzoimidazol-2-yl)-propan-1-ol

Controlled Product

CAS: 116040-91-6

Versatile small molecule scaffold

Formula: C₁₁H₁₄N₂O

Purity: Min. 95%

Molecular weight: 190.25 g/mol

Ref: 3D-REA04091