CAS 116047-27-9

7-Bromo-3,4-dihydro-2-(phenylmethylene)-1(2H)-naphthalenone

Description:

7-Bromo-3,4-dihydro-2-(phenylmethylene)-1(2H)-naphthalenone is an organic compound characterized by its complex structure, which includes a naphthalenone core with a bromine substituent and a phenylmethylene group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The compound may display significant fluorescence properties, which can be useful in applications such as organic light-emitting diodes (OLEDs) or as a fluorescent probe in biological systems. Additionally, its structural features suggest potential biological activity, which could be explored in medicinal chemistry. The compound's solubility and stability can vary depending on the solvent and environmental conditions, influencing its practical applications in research and industry. Overall, 7-Bromo-3,4-dihydro-2-(phenylmethylene)-1(2H)-naphthalenone is a versatile compound with potential implications in both synthetic and applied chemistry.

Formula: C₁₇H₁₃BrO

InChI: InChI=1S/C17H13BrO/c18-15-9-8-13-6-7-14(17(19)16(13)11-15)10-12-4-2-1-3-5-12/h1-5,8-11H,6-7H2

InChI key: InChIKey=YCRZFEMZBMBFGN-UHFFFAOYSA-N

SMILES: O=C1C=2C(CCC1=CC3=CC=CC=C3)=CC=C(Br)C2

Synonyms:

• 7-Bromo-3,4-dihydro-2-(phenylmethylene)-1(2H)-naphthalenone
• 1(2H)-Naphthalenone, 7-bromo-3,4-dihydro-2-(phenylmethylene)-

1(2H)-Naphthalenone, 7-bromo-3,4-dihydro-2-(phenylmethylene)-

CAS: 116047-27-9

Formula: C₁₇H₁₃BrO

Molecular weight: 313.1885

Ref: IN-DA000BHJ