
CAS 1160472-69-4
:3′-Chloro-6-methoxy[1,1′-biphenyl]-3-methanol
Description:
3′-Chloro-6-methoxy[1,1′-biphenyl]-3-methanol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 3′ position and a methoxy group at the 6 position on one of the phenyl rings contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The hydroxymethyl group at the 3 position enhances its solubility in polar solvents and may influence its biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the biphenyl framework, which can affect its absorption and distribution in biological systems. Additionally, the presence of functional groups such as the methoxy and hydroxymethyl groups may allow for hydrogen bonding interactions, impacting its overall stability and reactivity. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.
Formula:C14H13ClO2
InChI:InChI=1S/C14H13ClO2/c1-17-14-6-5-10(9-16)7-13(14)11-3-2-4-12(15)8-11/h2-8,16H,9H2,1H3
InChI key:InChIKey=MTADGZWDLUDJEW-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(CO)C=C1)C2=CC(Cl)=CC=C2
Synonyms:- [1,1′-Biphenyl]-3-methanol, 3′-chloro-6-methoxy-
- [3-(3-Chlorophenyl)-4-methoxyphenyl]methanol
- (3′-Chloro-6-methoxy-biphenyl-3-yl)-methanol
- 3′-Chloro-6-methoxy[1,1′-biphenyl]-3-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.