CAS 1160474-43-0

5-Bromo-3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-benzofurancarboxylic acid

Description:

5-Bromo-3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-benzofurancarboxylic acid is a chemical compound characterized by its complex structure, which includes a benzofuran moiety, a bromine substituent, and an amide functional group. This compound features a carboxylic acid group, contributing to its acidic properties, and a dimethylethoxycarbonyl group that enhances its stability and solubility in organic solvents. The presence of the bromine atom introduces unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in biological interactions. Additionally, the compound's characteristics may allow for modifications that could lead to derivatives with enhanced biological activity or selectivity. Overall, 5-Bromo-3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-benzofurancarboxylic acid exemplifies a versatile compound with potential utility in synthetic and medicinal chemistry.

Formula: C₁₄H₁₄BrNO₅

InChI: InChI=1S/C14H14BrNO5/c1-14(2,3)21-13(19)16-10-8-6-7(15)4-5-9(8)20-11(10)12(17)18/h4-6H,1-3H3,(H,16,19)(H,17,18)

InChI key: InChIKey=JHXLHVUPGWZODE-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C=1C=2C(OC1C(O)=O)=CC=C(Br)C2

Synonyms:

• 5-Bromo-3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-benzofurancarboxylic acid
• 2-Benzofurancarboxylic acid, 5-bromo-3-[[(1,1-dimethylethoxy)carbonyl]amino]-
• 5-BROMO-3-((TERT-BUTOXYCARBONYL)AMINO)BENZOFURAN-2-CARBOXYLIC ACID
• 5-Bromo-3-[(tert-butoxycarbonyl)amino]-1-benzofuran-2-carboxylic acid