CymitQuimica logo

CAS 1160474-66-7

:

2-(Acetylamino)-5-bromo-3-thiophenecarboxylic acid

Description:
2-(Acetylamino)-5-bromo-3-thiophenecarboxylic acid is a chemical compound characterized by its unique structure, which includes a thiophene ring, an acetylamino group, and a carboxylic acid functional group. The presence of the bromine atom at the 5-position of the thiophene ring contributes to its reactivity and potential applications in various chemical reactions. The acetylamino group enhances its solubility in polar solvents and may influence its biological activity, making it of interest in pharmaceutical research. The carboxylic acid group provides acidic properties, allowing for potential interactions with bases and other nucleophiles. This compound may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, which are common in thiophene derivatives. Its molecular structure suggests that it could participate in various synthetic pathways, making it a valuable intermediate in organic synthesis. Overall, 2-(Acetylamino)-5-bromo-3-thiophenecarboxylic acid is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C7H6BrNO3S
InChI:InChI=1S/C7H6BrNO3S/c1-3(10)9-6-4(7(11)12)2-5(8)13-6/h2H,1H3,(H,9,10)(H,11,12)
InChI key:InChIKey=LWJIUZZIQCPFSM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(NC(C)=O)SC(Br)=C1
Synonyms:
  • 3-Thiophenecarboxylic acid, 2-(acetylamino)-5-bromo-
  • 2-(Acetylamino)-5-bromo-3-thiophenecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.