CAS 1160474-78-1
:3,4-Dihydro-4-methyl-2H-1,4-benzoxazine-6-carboxylic acid hydrazide
Description:
3,4-Dihydro-4-methyl-2H-1,4-benzoxazine-6-carboxylic acid hydrazide is a chemical compound characterized by its unique structural features, which include a benzoxazine ring and a hydrazide functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the hydrazide group suggests that it may participate in various chemical reactions, including condensation and hydrazone formation. Additionally, the benzoxazine moiety is known for its thermal stability and potential applications in polymer chemistry. The compound may also display biological activity, making it of interest in medicinal chemistry. Its solubility and interaction with solvents can vary based on the functional groups present, influencing its application in different fields such as pharmaceuticals or materials science. Overall, 3,4-Dihydro-4-methyl-2H-1,4-benzoxazine-6-carboxylic acid hydrazide represents a versatile structure with potential utility in various chemical and biological contexts.
Formula:C10H13N3O2
InChI:InChI=1S/C10H13N3O2/c1-13-4-5-15-9-3-2-7(6-8(9)13)10(14)12-11/h2-3,6H,4-5,11H2,1H3,(H,12,14)
InChI key:InChIKey=XGPUDEQIBOZZBC-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC=C(C(NN)=O)C2)OCC1
Synonyms:- 3,4-Dihydro-4-methyl-2H-1,4-benzoxazine-6-carboxylic acid hydrazide
- 2H-1,4-Benzoxazine-6-carboxylic acid, 3,4-dihydro-4-methyl-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,4-Dihydro-4-methyl-2H-1,4-benzoxazine-6-carbohydrazide
CAS:3,4-Dihydro-4-methyl-2H-1,4-benzoxazine-6-carbohydrazideColor and Shape:SolidMolecular weight:207.23g/mol
