
CAS 116049-78-6
:2-[4-[(2R)-2-[[(2R)-2-(3-Chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetic acid
Description:
The chemical substance known as 2-[4-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetic acid, with the CAS number 116049-78-6, is a synthetic compound that belongs to the class of phenoxyacetic acids. It is characterized by its complex molecular structure, which includes a phenoxy group, a chiral center, and an amino alcohol moiety. This compound exhibits properties typical of both acidic and basic functional groups, allowing it to participate in various chemical reactions. It is often studied for its potential biological activities, including its role as a pharmacological agent. The presence of a chlorophenyl group may influence its lipophilicity and biological interactions. Additionally, the compound's stereochemistry is significant, as it can affect its pharmacodynamics and pharmacokinetics. Overall, this substance is of interest in medicinal chemistry and may have applications in drug development or therapeutic interventions.
Formula:C19H22ClNO4
InChI:InChI=1S/C19H22ClNO4/c1-13(21-11-18(22)15-3-2-4-16(20)10-15)9-14-5-7-17(8-6-14)25-12-19(23)24/h2-8,10,13,18,21-22H,9,11-12H2,1H3,(H,23,24)/t13-,18+/m1/s1
InChI key:InChIKey=ZGGNJJJYUVRADP-ACJLOTCBSA-N
SMILES:[C@@H](CN[C@@H](CC1=CC=C(OCC(O)=O)C=C1)C)(O)C2=CC(Cl)=CC=C2
Synonyms:- Acetic acid, 2-[4-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]-
- BRL 44092
- Acetic acid, [4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]-, [R-(R*,R*)]-
- Acetic acid, [4-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]-
- 2-[4-[(2R)-2-[[(2R)-2-(3-Chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
SB-206606
CAS:SB-206606 is a novel, highly specific radioactive ligand for the β3-adrenergic receptor.
Formula:C19H22ClNO4Color and Shape:SolidMolecular weight:363.83
