CAS 116049-87-7
:2-deoxy-2-fluoroinositol
Description:
2-Deoxy-2-fluoroinositol is a fluorinated derivative of inositol, characterized by the substitution of a fluorine atom at the second carbon position of the inositol ring. This modification alters its chemical properties and biological activity compared to its non-fluorinated counterpart. The presence of the fluorine atom can enhance the compound's stability and lipophilicity, potentially influencing its interaction with biological systems. 2-Deoxy-2-fluoroinositol is of interest in various fields, including medicinal chemistry and biochemistry, particularly for its potential role in studying inositol signaling pathways and its implications in metabolic disorders. The compound may exhibit unique pharmacological properties, making it a candidate for further research in drug development. Its molecular structure includes multiple hydroxyl groups, which contribute to its solubility in polar solvents and its ability to form hydrogen bonds. Overall, 2-deoxy-2-fluoroinositol represents a significant modification of inositol that could provide insights into the functional roles of inositol derivatives in biological systems.
Formula:C6H11FO5
InChI:InChI=1/C6H11FO5/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6,8-12H/t1?,2-,3+,4-,5-,6?/m1/s1
Synonyms:- 2-Deoxy-2-fluoro-myo-inositol
- DL-epi-Inositol, 2-deoxy-2-fluoro-
- (1R,2S,4S,5S)-6-fluorocyclohexane-1,2,3,4,5-pentol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.