CAS 116057-81-9
:N,N-DIMETHYLACETAMIDE-D9
Description:
N,N-Dimethylacetamide-D9 (CAS 116057-81-9) is a deuterated form of N,N-dimethylacetamide, a colorless, hygroscopic liquid commonly used as a solvent in organic synthesis and various industrial applications. The presence of deuterium, a stable isotope of hydrogen, in its molecular structure enhances its utility in NMR spectroscopy, allowing for more precise studies of molecular interactions and dynamics. This compound exhibits polar aprotic characteristics, making it effective in dissolving a wide range of polar and nonpolar substances. Its high boiling point and moderate viscosity contribute to its effectiveness as a solvent in high-temperature reactions. Additionally, N,N-dimethylacetamide-D9 is known for its relatively low toxicity compared to other solvents, although appropriate safety measures should still be observed during handling. Its unique isotopic labeling also makes it valuable in research fields such as drug development and metabolic studies, where tracking the behavior of molecules in biological systems is essential.
Formula:C4D9NO
InChI:InChI=1/C4H9NO/c1-4(6)5(2)3/h1-3H3/i1D3,2D3,3D3
SMILES:C(C(=O)N(C([2H])([2H])[2H])C([2H])([2H])[2H])([2H])([2H])[2H]
Synonyms:- N,N-Dimethylacetamide-D9, 99 Atom % D
- N,N-Dimethylacetamide-d9(Isotopic)
- N,N-Dimethylacetamide-d9, 99% (Isotopic)
- N,N-bis[(2H3)methyl](2H3)acetamide
- N,N-Dimethylacetamide-D9
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N,N-Dimethylacetamide-d{9}, 99% (Isotopic)
CAS:N,N-Dimethylacetamide-d{9} is a common solvent used in NMR spectroscopy. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU
Formula:C4D9NOPurity:99%Color and Shape:Clear colorless, LiquidMolecular weight:96.19N,N-Dimethylacetamide-d9 (DMA-d9) for NMR spectroscopy, 99 Atom %D
CAS:Formula:C4D9ONMolecular weight:96.18



